What is the common name for Veratraldehyde?
Edited
Name | Type | Language |
---|---|---|
VERATRIC ALDEHYDE Sources: | Common Name | English |
BENZALDEHYDE, 3,4-DIMETHOXY- Sources: | Systematic Name | English |
VERATRALDEHYDE [FCC] Sources: | Common Name | English |
VANILLIN METHYL ETHER Sources: | Systematic Name | English |
What is another name for 3/4 Dimethoxybenzaldehyde?
3,4-Dimethoxybenzaldehyde, also known as veratric aldehyde, belongs to the class of organic compounds known as dimethoxybenzenes. These are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. 3,4-Dimethoxybenzaldehyde is a sweet, caramel, and cherry tasting compound.
What is C9H10O3?
Ethyl salicylate | C9H10O3 – PubChem.
Is Veratraldehyde vanilla?
Chemical Properties Veratraldehyde has a very sweet, woody, vanilla-like odor with a warm, sweet, vanilla-like taste.
What is the Iupac name of vanillin?
4-hydroxy-3-methoxybenzaldehyde
IUPAC Name | 4-hydroxy-3-methoxybenzaldehyde |
---|---|
Alternative Names | vanillin 4-Hydroxy-3-methoxybenzaldehyde Vanillaldehyde Vanillic aldehyde 2-Methoxy-4-formylphenol |
Molecular Formula | C8H8O3 |
Molar Mass | 152.149 g/mol |
InChI | InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 |
Is 3/4 Dimethoxybenzaldehyde a solid or liquid?
Specifications
CAS Min % | 99.0 |
---|---|
Formula Weight | 166.18 |
Physical Form | Lumps or Fused Solid |
Percent Purity | 99+% |
Water | 1% max. (K.F.) |
What is the simplest ester?
methyl methanoate
Methyl formate, also called methyl methanoate, is the methyl ester of formic acid. The simplest example of an ester, it is a colorless liquid with an ethereal odour, high vapor pressure, and low surface tension.
What is the molecular formula of indan 1 one?
1-Indanone
PubChem CID | 6735 |
---|---|
Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
Molecular Formula | C9H8O |
Synonyms | 1-Indanone 83-33-0 Indan-1-one 2,3-Dihydro-1H-inden-1-one INDANONE More… |
Molecular Weight | 132.16 |
What does Veratraldehyde smell like?
Description and usage notes: Soft balsamic / vanilla note and replacement / booster for Heliotropine. Veratraldehyde comes as waxy, white to cream coloured powder or flakes.
What is Iupac name of tert-butyl iodide?
tert-Butyl iodide
PubChem CID | 11206 |
---|---|
Structure | Find Similar Structures |
Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
Molecular Formula | C4H9I |
Synonyms | tert-Butyl iodide 2-Iodo-2-methylpropane 558-17-8 PROPANE, 2-IODO-2-METHYL- Trimethyliodomethane More… |
What is the nomenclature for aldehydes?
Naming Aldehydes. According to the IUPAC system of nomenclature -al is attached as a suffix to parent alkane for the naming of aldehydes. For example, H 2C=O is named as per the IUPAC system as methanal, commonly known as formaldehyde.
What is veratraldehyde?
Veratraldehyde is a dimethoxybenzene that is benzaldehyde substituted by methoxy groups at positions 3 and 4. It is found in peppermint, ginger, raspberry, and other fruits. It has a role as an antifungal agent.
Which part of an alkyl group forms an aldehyde group?
In the general structure of an aldehyde, it can be noticed that the two hydrogen atoms of the halogen group have been replaced by a doubly bonded oxygen atom. This -CHO is the part that forms an aldehyde group when attached to an alkyl chain.
Why are aldehydes and ketones called by common names?
It is not always necessary to include numbering in the naming. Instead of IUPAC name aldehydes and ketones are also called by their common names. For aldehydes and ketones, the names are reflected in Greek and Latin term. Greek letters such as α, β etc. are used for the location of the substituents in the carbon chain.