What is Bromoacetophenone used for?
2-Bromoacetophenone has been used in the analysis of organic acids involving the formation of phenacyl derivatives.
What is the molecular weight of c8h7bro?
199.04
4′-Bromoacetophenone
PubChem CID | 7466 |
---|---|
Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
Molecular Formula | C8H7BrO |
Synonyms | 4′-Bromoacetophenone 99-90-1 1-(4-Bromophenyl)ethanone p-Bromoacetophenone 4-BROMOACETOPHENONE More… |
Molecular Weight | 199.04 |
Is 4 Bromoacetophenone soluble in water?
Store below +30°C. Soluble in Chloroform. Insoluble in water.
How do you make Phenacyl bromide?
Phenacyl bromide is the organic compound with the formula C6H5C(O)CH2Br. This colourless solid is a powerful lachrymator as well as a useful precursor to other organic compounds. It is prepared by bromination of acetophenone: C6H5C(O)CH3 + Br2 → C6H5C(O)CH2Br + HBr.
What is the Iupac name of benzophenone?
diphenylmethanone
IUPAC Name | diphenylmethanone |
---|---|
Alternative Names | BENZOPHENONE diphenylmethanone Diphenyl ketone |
Molecular Formula | C13H10O |
Molar Mass | 182.222 g/mol |
InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
What is the boiling point of acetophenone?
395.6°F (202°C)Acetophenone / Boiling point
Pure acetophenone is a colourless liquid, with a melting point of 20.2 °C (68.4 °F) and a boiling point of 202.4 °C (396.3 °F). It is only slightly soluble in water but is freely soluble in ethanol (ethyl alcohol), diethyl ether, and chloroform.
What is the functional group of acetophenone?
Acetophenone contains both benzene and a ketone functional group.
What are the characteristics of acetophenone?
Pure acetophenone is a colourless liquid, with a melting point of 20.2 °C (68.4 °F) and a boiling point of 202.4 °C (396.3 °F). It is only slightly soluble in water but is freely soluble in ethanol (ethyl alcohol), diethyl ether, and chloroform.
What is another name for benzophenone?
Benzophenone
Names | |
---|---|
Preferred IUPAC name Diphenylmethanone | |
Other names Benzophenone Phenyl ketone Diphenyl ketone Benzoylbenzene Benzoylphenyl | |
Identifiers | |
CAS Number | 119-61-9 |
How is benzophenone formed from Benzonitrile?
Answer: Explanation: Benzonitrile reacts with phenyl magnesium bromide in presence of dry ether to give an imine complex which on acid hydrolysis gives a benzophenone. During reaction benzonitrile and phenyl magnesium bromide should be taken in equimolecular proportion.
What does acetophenone smell like?
Acetophenone appears as a colorless liquid with a sweet pungent taste and odor resembling the odor of oranges.